Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Aluminum shot, nominally 9.5mm (0.375in) flattened/spherical shape, 99.99% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
5 Percent Rhodium on Activated Carbon Powder, Reduced, Water Wet, 27 microns, BASF Catalyst, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7440-16-6 Molecular Formula: Rh Molecular Weight (g/mol): 102.91 MDL Number: MFCD00011201 MFCD03458392 InChI Key: MHOVAHRLVXNVSD-UHFFFAOYSA-N IUPAC Name: rhodium SMILES: [Rh]
| CAS | 7440-16-6 |
|---|---|
| Molecular Weight (g/mol) | 102.91 |
| MDL Number | MFCD00011201 MFCD03458392 |
| SMILES | [Rh] |
| IUPAC Name | rhodium |
| InChI Key | MHOVAHRLVXNVSD-UHFFFAOYSA-N |
| Molecular Formula | Rh |
Copper(II) tetrafluoroborate, 45% aq. soln.
CAS: 38465-60-0 Molecular Formula: B2CuF8 Molecular Weight (g/mol): 237.15 MDL Number: MFCD00016054 InChI Key: HMUNZEYTSRPVBE-UHFFFAOYSA-N Synonym: copper fluoroborate,copper fluoborate,copper ii tetrafluoroborate,copper ditetrafluoroborate,cupric tetrafluoroborate hydrate,copper ii tetrafluoroborate in h2o,cupric fluoborate,copper ii fluoborate,copper 2+ ditetrafluoroborate,copper 2+ tetrafluoroborate 1- PubChem CID: 170058 IUPAC Name: copper;ditetrafluoroborate SMILES: [Cu++].F[B-](F)(F)F.F[B-](F)(F)F
| PubChem CID | 170058 |
|---|---|
| CAS | 38465-60-0 |
| Molecular Weight (g/mol) | 237.15 |
| MDL Number | MFCD00016054 |
| SMILES | [Cu++].F[B-](F)(F)F.F[B-](F)(F)F |
| Synonym | copper fluoroborate,copper fluoborate,copper ii tetrafluoroborate,copper ditetrafluoroborate,cupric tetrafluoroborate hydrate,copper ii tetrafluoroborate in h2o,cupric fluoborate,copper ii fluoborate,copper 2+ ditetrafluoroborate,copper 2+ tetrafluoroborate 1- |
| IUPAC Name | copper;ditetrafluoroborate |
| InChI Key | HMUNZEYTSRPVBE-UHFFFAOYSA-N |
| Molecular Formula | B2CuF8 |
Ferrous Sulfate Heptahydrate, >99%, MP Biomedicals
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 IUPAC Name: λ²-iron(2+) heptahydrate sulfate SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| IUPAC Name | λ²-iron(2+) heptahydrate sulfate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Antimony rod, 12.7mm (0.50in) dia x 10cm (3.9in) long, 99.8% (metals basis)
CAS: 7440-36-0 Molecular Formula: Sb Molecular Weight (g/mol): 121.76 MDL Number: MFCD00011211 MFCD00134030 InChI Key: WATWJIUSRGPENY-UHFFFAOYSA-N Synonym: powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german PubChem CID: 5354495 ChEBI: CHEBI:30304 IUPAC Name: antimony SMILES: [Sb]
| PubChem CID | 5354495 |
|---|---|
| CAS | 7440-36-0 |
| Molecular Weight (g/mol) | 121.76 |
| ChEBI | CHEBI:30304 |
| MDL Number | MFCD00011211 MFCD00134030 |
| SMILES | [Sb] |
| Synonym | powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german |
| IUPAC Name | antimony |
| InChI Key | WATWJIUSRGPENY-UHFFFAOYSA-N |
| Molecular Formula | Sb |
Chromium cubes, 12.5mm (0.492in) square, 99.97% (metals basis)
CAS: 7440-47-3 Molecular Formula: Cr Molecular Weight (g/mol): 52.00 MDL Number: MFCD00010944 InChI Key: VYZAMTAEIAYCRO-UHFFFAOYSA-N Synonym: chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 PubChem CID: 23976 ChEBI: CHEBI:28073 IUPAC Name: chromium SMILES: [Cr]
| PubChem CID | 23976 |
|---|---|
| CAS | 7440-47-3 |
| Molecular Weight (g/mol) | 52.00 |
| ChEBI | CHEBI:28073 |
| MDL Number | MFCD00010944 |
| SMILES | [Cr] |
| Synonym | chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 |
| IUPAC Name | chromium |
| InChI Key | VYZAMTAEIAYCRO-UHFFFAOYSA-N |
| Molecular Formula | Cr |
10-(Pentafluorophenoxycarbonyl)decyltriethoxysilane, 95%
CAS: 1197981-08-0 Molecular Formula: C23H35F5O5Si Molecular Weight (g/mol): 514.605 MDL Number: MFCD13181916 InChI Key: WQFFEEIHQJVCHR-UHFFFAOYSA-N Synonym: 2,3,4,5,6-pentafluorophenyl 11-triethoxysilyl undecanoate,10-pentafluorophenoxycarbonyl decyltriethoxysilane,10-pentafluorophenoxycarbonyl decyl triethoxysilane PubChem CID: 99738205 IUPAC Name: (2,3,4,5,6-pentafluorophenyl) 11-triethoxysilylundecanoate SMILES: CCO[Si](CCCCCCCCCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)(OCC)OCC
| PubChem CID | 99738205 |
|---|---|
| CAS | 1197981-08-0 |
| Molecular Weight (g/mol) | 514.605 |
| MDL Number | MFCD13181916 |
| SMILES | CCO[Si](CCCCCCCCCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)(OCC)OCC |
| Synonym | 2,3,4,5,6-pentafluorophenyl 11-triethoxysilyl undecanoate,10-pentafluorophenoxycarbonyl decyltriethoxysilane,10-pentafluorophenoxycarbonyl decyl triethoxysilane |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 11-triethoxysilylundecanoate |
| InChI Key | WQFFEEIHQJVCHR-UHFFFAOYSA-N |
| Molecular Formula | C23H35F5O5Si |
Copper(II) oxide, 99.7% (metals basis)
CAS: 1317-38-0 Molecular Formula: CuO Molecular Weight (g/mol): 79.55 MDL Number: MFCD00010979 InChI Key: KKCXRELNMOYFLS-UHFFFAOYSA-N Synonym: cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide PubChem CID: 14829 IUPAC Name: copper(2+) oxidandiide SMILES: [O--].[Cu++]
| PubChem CID | 14829 |
|---|---|
| CAS | 1317-38-0 |
| Molecular Weight (g/mol) | 79.55 |
| MDL Number | MFCD00010979 |
| SMILES | [O--].[Cu++] |
| Synonym | cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide |
| IUPAC Name | copper(2+) oxidandiide |
| InChI Key | KKCXRELNMOYFLS-UHFFFAOYSA-N |
| Molecular Formula | CuO |
Tin wire, 1.0mm (0.04in) dia, Puratronic™, 99.998% (metals basis)
CAS: 7440-31-5 Molecular Formula: Sn Molecular Weight (g/mol): 118.71 MDL Number: MFCD00133862 InChI Key: ATJFFYVFTNAWJD-UHFFFAOYSA-N Synonym: powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german PubChem CID: 5352426 ChEBI: CHEBI:32990 IUPAC Name: tin SMILES: [Sn]
| PubChem CID | 5352426 |
|---|---|
| CAS | 7440-31-5 |
| Molecular Weight (g/mol) | 118.71 |
| ChEBI | CHEBI:32990 |
| MDL Number | MFCD00133862 |
| SMILES | [Sn] |
| Synonym | powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german |
| IUPAC Name | tin |
| InChI Key | ATJFFYVFTNAWJD-UHFFFAOYSA-N |
| Molecular Formula | Sn |
Titanium(IV) oxide bis(2,4-pentanedionate)
CAS: 14024-64-7 Molecular Formula: C10H16O5Ti Molecular Weight (g/mol): 264.1 MDL Number: MFCD00013505 InChI Key: ADVORQMAWLEPOI-UHFFFAOYSA-N Synonym: bis acetylacetonato titanium iv oxide,bis 4-hydroxypent-3-en-2-one ; titanium ii oxide PubChem CID: 74765597 IUPAC Name: 4-hydroxypent-3-en-2-one;oxotitanium SMILES: CC(=CC(=O)C)O.CC(=CC(=O)C)O.O=[Ti]
| PubChem CID | 74765597 |
|---|---|
| CAS | 14024-64-7 |
| Molecular Weight (g/mol) | 264.1 |
| MDL Number | MFCD00013505 |
| SMILES | CC(=CC(=O)C)O.CC(=CC(=O)C)O.O=[Ti] |
| Synonym | bis acetylacetonato titanium iv oxide,bis 4-hydroxypent-3-en-2-one ; titanium ii oxide |
| IUPAC Name | 4-hydroxypent-3-en-2-one;oxotitanium |
| InChI Key | ADVORQMAWLEPOI-UHFFFAOYSA-N |
| Molecular Formula | C10H16O5Ti |
Triethylsilane, 99%
CAS: 617-86-7 Molecular Formula: C6H16Si Molecular Weight (g/mol): 116.28 InChI Key: QXTIBZLKQPJVII-UHFFFAOYSA-N Synonym: triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes PubChem CID: 6327258 IUPAC Name: triethylsilicon SMILES: CC[Si](CC)CC
| PubChem CID | 6327258 |
|---|---|
| CAS | 617-86-7 |
| Molecular Weight (g/mol) | 116.28 |
| SMILES | CC[Si](CC)CC |
| Synonym | triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes |
| IUPAC Name | triethylsilicon |
| InChI Key | QXTIBZLKQPJVII-UHFFFAOYSA-N |
| Molecular Formula | C6H16Si |
Arsenic(III) sulfide, 99.999% (metals basis)
CAS: 1303-33-9 Molecular Formula: As2S3 Molecular Weight (g/mol): 246.02 MDL Number: MFCD00003435 InChI Key: CUGMJFZCCDSABL-UHFFFAOYSA-N IUPAC Name: diarsenic(3+) trisulfanediide SMILES: [S--].[S--].[S--].[As+3].[As+3]
| CAS | 1303-33-9 |
|---|---|
| Molecular Weight (g/mol) | 246.02 |
| MDL Number | MFCD00003435 |
| SMILES | [S--].[S--].[S--].[As+3].[As+3] |
| IUPAC Name | diarsenic(3+) trisulfanediide |
| InChI Key | CUGMJFZCCDSABL-UHFFFAOYSA-N |
| Molecular Formula | As2S3 |
Palladium granules, 99.8% (metals basis)
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Iron(III) hydroxide, alpha-phase
CAS: 20344-49-4 Molecular Formula: FeHO2 Molecular Weight (g/mol): 88.851 MDL Number: MFCD00064782 InChI Key: AEIXRCIKZIZYPM-UHFFFAOYSA-M Synonym: hydroxy oxo iron,goethite,lepidocrocite,iron hydroxide oxide,goethite fe oh o,iron hydroxide oxide fe oh o,iron iii oxide-hydroxide,ferric acid,iron pigment yellow,ferric hydroxide oxide PubChem CID: 91502 IUPAC Name: hydroxy(oxo)iron SMILES: O[Fe]=O
| PubChem CID | 91502 |
|---|---|
| CAS | 20344-49-4 |
| Molecular Weight (g/mol) | 88.851 |
| MDL Number | MFCD00064782 |
| SMILES | O[Fe]=O |
| Synonym | hydroxy oxo iron,goethite,lepidocrocite,iron hydroxide oxide,goethite fe oh o,iron hydroxide oxide fe oh o,iron iii oxide-hydroxide,ferric acid,iron pigment yellow,ferric hydroxide oxide |
| IUPAC Name | hydroxy(oxo)iron |
| InChI Key | AEIXRCIKZIZYPM-UHFFFAOYSA-M |
| Molecular Formula | FeHO2 |
Lanthanum(III) sulfate, anhydrous, 99.9% (REO)
CAS: 10099-60-2 Molecular Formula: La2O12S3 Molecular Weight (g/mol): 565.979 MDL Number: MFCD00011070 InChI Key: VQEHIYWBGOJJDM-UHFFFAOYSA-H Synonym: lanthanum sulfate,sulfuric acid, lanthanum 3+ salt 3:2,dilanthanum 3+ trisulphate,lanthanum iii sulfate 2:3,dilanthanum 3+ trisulfate,lanthansulfat,lanthanum sulphate,lanthanum 3+ trisulfate,2la.3so4,lanthanum iii sulfatehydrate PubChem CID: 159259 IUPAC Name: lanthanum(3+);trisulfate SMILES: [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[La+3].[La+3]
| PubChem CID | 159259 |
|---|---|
| CAS | 10099-60-2 |
| Molecular Weight (g/mol) | 565.979 |
| MDL Number | MFCD00011070 |
| SMILES | [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[La+3].[La+3] |
| Synonym | lanthanum sulfate,sulfuric acid, lanthanum 3+ salt 3:2,dilanthanum 3+ trisulphate,lanthanum iii sulfate 2:3,dilanthanum 3+ trisulfate,lanthansulfat,lanthanum sulphate,lanthanum 3+ trisulfate,2la.3so4,lanthanum iii sulfatehydrate |
| IUPAC Name | lanthanum(3+);trisulfate |
| InChI Key | VQEHIYWBGOJJDM-UHFFFAOYSA-H |
| Molecular Formula | La2O12S3 |